C14H20N2O4S2 — CID 25234292
N-(3-methoxypropyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 25234292) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-(3-methoxypropyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 25234292 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(3-methoxypropyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | COCCCNC(=O)c1ccc2c(c1)N(S(C)(=O)=O)CCS2 |
| InChI | InChI=1S/C14H20N2O4S2/c1-20-8-3-6-15-14(17)11-4-5-13-12(10-11)16(7-9-21-13)22(2,18)19/h4-5,10H,3,6-9H2,1-2H3,(H,15,17) |
| InChIKey | XTQDWXHRDDIKJJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|