C20H11Cl3N6O — CID 25235257
N-(2-chloro-4-pyridinyl)-5-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-1,3,4-oxadiazol-2-amine (PubChem CID 25235257) has the molecular formula C20H11Cl3N6O and a molecular weight of 457.71 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-5-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(2-chloro-4-pyridinyl)-5-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 25235257 |
| Molecular Formula | C20H11Cl3N6O |
| Molecular Weight | 457.71 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-5-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-1,3,4-oxadiazol-2-amine |
| SMILES | Clc1cc(Nc2nnc(-c3ccc4nc(-c5c(Cl)cccc5Cl)[nH]c4c3)o2)ccn1 |
| InChI | InChI=1S/C20H11Cl3N6O/c21-12-2-1-3-13(22)17(12)18-26-14-5-4-10(8-15(14)27-18)19-28-29-20(30-19)25-11-6-7-24-16(23)9-11/h1-9H,(H,26,27)(H,24,25,29) |
| InChIKey | RTCQRWIAYHAAMH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.71 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|