C11H12ClNOS — CID 25237569
5-chloro-N,N-bis(prop-2-enyl)thiophene-2-carboxamide (PubChem CID 25237569) has the molecular formula C11H12ClNOS and a molecular weight of 241.74 g/mol. Its IUPAC name is 5-chloro-N,N-bis(prop-2-enyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N,N-bis(prop-2-enyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 25237569 |
| Molecular Formula | C11H12ClNOS |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 5-chloro-N,N-bis(prop-2-enyl)thiophene-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H12ClNOS/c1-3-7-13(8-4-2)11(14)9-5-6-10(12)15-9/h3-6H,1-2,7-8H2 |
| InChIKey | XEQDOVLJQNYOPV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|