C10H11F4N3O4 — CID 25239838
2,2,3,3-tetrafluoropropyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate (PubChem CID 25239838) has the molecular formula C10H11F4N3O4 and a molecular weight of 313.21 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate.
| Compound Name | 2,2,3,3-tetrafluoropropyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate |
|---|---|
| PubChem CID | 25239838 |
| Molecular Formula | C10H11F4N3O4 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate |
| SMILES | COc1cc(NC(=O)OCC(F)(F)C(F)F)nc(OC)n1 |
| InChI | InChI=1S/C10H11F4N3O4/c1-19-6-3-5(15-8(17-6)20-2)16-9(18)21-4-10(13,14)7(11)12/h3,7H,4H2,1-2H3,(H,15,16,17,18) |
| InChIKey | UOZDCWGMEYIIBP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|