C15H18F5N3O5 — CID 3122103
4,4,5,5,5-pentafluoropentyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate (PubChem CID 3122103) has the molecular formula C15H18F5N3O5 and a molecular weight of 415.32 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoropentyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate.
| Compound Name | 4,4,5,5,5-pentafluoropentyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 3122103 |
| Molecular Formula | C15H18F5N3O5 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4,4,5,5,5-pentafluoropentyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
| SMILES | COc1cc(NC(=O)CCC(=O)OCCCC(F)(F)C(F)(F)F)nc(OC)n1 |
| InChI | InChI=1S/C15H18F5N3O5/c1-26-11-8-9(22-13(23-11)27-2)21-10(24)4-5-12(25)28-7-3-6-14(16,17)15(18,19)20/h8H,3-7H2,1-2H3,(H,21,22,23,24) |
| InChIKey | HPXQFUARGFOSJK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|