C13H17N3O5 — CID 658466
prop-2-enyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate (PubChem CID 658466) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is prop-2-enyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate.
| Compound Name | prop-2-enyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 658466 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | prop-2-enyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobutanoate |
| SMILES | C=CCOC(=O)CCC(=O)Nc1cc(OC)nc(OC)n1 |
| InChI | InChI=1S/C13H17N3O5/c1-4-7-21-12(18)6-5-10(17)14-9-8-11(19-2)16-13(15-9)20-3/h4,8H,1,5-7H2,2-3H3,(H,14,15,16,17) |
| InChIKey | MXMQHKDDBRPCTJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|