C12H12F3N3O5 — CID 4247701
2,2,2-trifluoroethyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobut-2-enoate (PubChem CID 4247701) has the molecular formula C12H12F3N3O5 and a molecular weight of 335.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobut-2-enoate.
| Compound Name | 2,2,2-trifluoroethyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4247701 |
| Molecular Formula | C12H12F3N3O5 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-[(2,6-dimethoxypyrimidin-4-yl)amino]-4-oxobut-2-enoate |
| SMILES | COc1cc(NC(=O)C=CC(=O)OCC(F)(F)F)nc(OC)n1 |
| InChI | InChI=1S/C12H12F3N3O5/c1-21-9-5-7(17-11(18-9)22-2)16-8(19)3-4-10(20)23-6-12(13,14)15/h3-5H,6H2,1-2H3,(H,16,17,18,19) |
| InChIKey | UUNAKKSKLFFHSE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|