C26H32N4O — CID 25253458
(5-cycloheptylbenzo[c][2,6]naphthyridin-8-yl)-(4-methyl-1,4-diazepan-1-yl)methanone (PubChem CID 25253458) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is (5-cycloheptylbenzo[c][2,6]naphthyridin-8-yl)-(4-methyl-1,4-diazepan-1-yl)methanone.
| Compound Name | (5-cycloheptylbenzo[c][2,6]naphthyridin-8-yl)-(4-methyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 25253458 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (5-cycloheptylbenzo[c][2,6]naphthyridin-8-yl)-(4-methyl-1,4-diazepan-1-yl)methanone |
| SMILES | CN1CCCN(C(=O)c2ccc3c(c2)nc(C2CCCCCC2)c2ccncc23)CC1 |
| InChI | InChI=1S/C26H32N4O/c1-29-13-6-14-30(16-15-29)26(31)20-9-10-21-23-18-27-12-11-22(23)25(28-24(21)17-20)19-7-4-2-3-5-8-19/h9-12,17-19H,2-8,13-16H2,1H3 |
| InChIKey | NWZVMVHSADVPNE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|