C24H23N5O — CID 25253608
[5-(3-aminophenyl)benzo[c][2,6]naphthyridin-8-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 25253608) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is [5-(3-aminophenyl)benzo[c][2,6]naphthyridin-8-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [5-(3-aminophenyl)benzo[c][2,6]naphthyridin-8-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 25253608 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [5-(3-aminophenyl)benzo[c][2,6]naphthyridin-8-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc3c(c2)nc(-c2cccc(N)c2)c2ccncc23)CC1 |
| InChI | InChI=1S/C24H23N5O/c1-28-9-11-29(12-10-28)24(30)17-5-6-19-21-15-26-8-7-20(21)23(27-22(19)14-17)16-3-2-4-18(25)13-16/h2-8,13-15H,9-12,25H2,1H3 |
| InChIKey | QSLAMUOYHCCHKK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|