C20H24N2O3S3 — CID 25254754
(5E)-3-(4-methylsulfanyl-1-morpholin-4-yl-1-oxobutan-2-yl)-5-(2-phenylethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 25254754) has the molecular formula C20H24N2O3S3 and a molecular weight of 436.62 g/mol. Its IUPAC name is (5E)-3-(4-methylsulfanyl-1-morpholin-4-yl-1-oxobutan-2-yl)-5-(2-phenylethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(4-methylsulfanyl-1-morpholin-4-yl-1-oxobutan-2-yl)-5-(2-phenylethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 25254754 |
| Molecular Formula | C20H24N2O3S3 |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | (5E)-3-(4-methylsulfanyl-1-morpholin-4-yl-1-oxobutan-2-yl)-5-(2-phenylethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CSCCC(C(=O)N1CCOCC1)N1C(=O)/C(=C\Cc2ccccc2)SC1=S |
| InChI | InChI=1S/C20H24N2O3S3/c1-27-14-9-16(18(23)21-10-12-25-13-11-21)22-19(24)17(28-20(22)26)8-7-15-5-3-2-4-6-15/h2-6,8,16H,7,9-14H2,1H3/b17-8+ |
| InChIKey | KDSTYTUPTWOISP-CAOOACKPSA-N |
| XLogP | 2.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|