C23H28O4S — CID 25257440
5-benzyl-4-[(4-tert-butylphenyl)methoxy]-5-ethyloxathiole 2,2-dioxide (PubChem CID 25257440) has the molecular formula C23H28O4S and a molecular weight of 400.54 g/mol. Its IUPAC name is 5-benzyl-4-[(4-tert-butylphenyl)methoxy]-5-ethyloxathiole 2,2-dioxide.
| Compound Name | 5-benzyl-4-[(4-tert-butylphenyl)methoxy]-5-ethyloxathiole 2,2-dioxide |
|---|---|
| PubChem CID | 25257440 |
| Molecular Formula | C23H28O4S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 5-benzyl-4-[(4-tert-butylphenyl)methoxy]-5-ethyloxathiole 2,2-dioxide |
| SMILES | CCC1(Cc2ccccc2)OS(=O)(=O)C=C1OCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H28O4S/c1-5-23(15-18-9-7-6-8-10-18)21(17-28(24,25)27-23)26-16-19-11-13-20(14-12-19)22(2,3)4/h6-14,17H,5,15-16H2,1-4H3 |
| InChIKey | DFKSUOYAFXDDPT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|