C20H19F3O4S — CID 25257893
5-benzyl-5-ethyl-4-[[4-(trifluoromethyl)phenyl]methoxy]oxathiole 2,2-dioxide (PubChem CID 25257893) has the molecular formula C20H19F3O4S and a molecular weight of 412.43 g/mol. Its IUPAC name is 5-benzyl-5-ethyl-4-[[4-(trifluoromethyl)phenyl]methoxy]oxathiole 2,2-dioxide.
| Compound Name | 5-benzyl-5-ethyl-4-[[4-(trifluoromethyl)phenyl]methoxy]oxathiole 2,2-dioxide |
|---|---|
| PubChem CID | 25257893 |
| Molecular Formula | C20H19F3O4S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 5-benzyl-5-ethyl-4-[[4-(trifluoromethyl)phenyl]methoxy]oxathiole 2,2-dioxide |
| SMILES | CCC1(Cc2ccccc2)OS(=O)(=O)C=C1OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3O4S/c1-2-19(12-15-6-4-3-5-7-15)18(14-28(24,25)27-19)26-13-16-8-10-17(11-9-16)20(21,22)23/h3-11,14H,2,12-13H2,1H3 |
| InChIKey | MYIJVJKPPGVOFD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|