C10H16O2 — CID 25258849
2-[3-[(2Z)-hexa-2,5-dienyl]oxiran-2-yl]ethanol (PubChem CID 25258849) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-[3-[(2Z)-hexa-2,5-dienyl]oxiran-2-yl]ethanol.
| Compound Name | 2-[3-[(2Z)-hexa-2,5-dienyl]oxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 25258849 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-[3-[(2Z)-hexa-2,5-dienyl]oxiran-2-yl]ethanol |
| SMILES | C=CC/C=C\CC1OC1CCO |
| InChI | InChI=1S/C10H16O2/c1-2-3-4-5-6-9-10(12-9)7-8-11/h2,4-5,9-11H,1,3,6-8H2/b5-4- |
| InChIKey | SEWWZGYVZOOBIY-PLNGDYQASA-N |
| XLogP | 1.66 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|