C27H24F3N7O4 — CID 25260174
(2R,3R,4S,5R)-2-[6-amino-8-(quinolin-6-ylmethylamino)purin-9-yl]-5-[(3,4,5-trifluorophenyl)methoxymethyl]oxolane-3,4-diol (PubChem CID 25260174) has the molecular formula C27H24F3N7O4 and a molecular weight of 567.53 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-(quinolin-6-ylmethylamino)purin-9-yl]-5-[(3,4,5-trifluorophenyl)methoxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-(quinolin-6-ylmethylamino)purin-9-yl]-5-[(3,4,5-trifluorophenyl)methoxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 25260174 |
| Molecular Formula | C27H24F3N7O4 |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-(quinolin-6-ylmethylamino)purin-9-yl]-5-[(3,4,5-trifluorophenyl)methoxymethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(NCc1ccc3ncccc3c1)n2[C@@H]1O[C@H](COCc2cc(F)c(F)c(F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H24F3N7O4/c28-16-7-14(8-17(29)20(16)30)10-40-11-19-22(38)23(39)26(41-19)37-25-21(24(31)34-12-35-25)36-27(37)33-9-13-3-4-18-15(6-13)2-1-5-32-18/h1-8,12,19,22-23,26,38-39H,9-11H2,(H,33,36)(H2,31,34,35)/t19-,22-,23-,26-/m1/s1 |
| InChIKey | FHFVZVSWLJLWTQ-VJUOEERUSA-N |
| XLogP | 2.82 |
| TPSA | 153.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|