C30H29FN6O3S2 — CID 25267071
N-[[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 25267071) has the molecular formula C30H29FN6O3S2 and a molecular weight of 604.73 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 25267071 |
| Molecular Formula | C30H29FN6O3S2 |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | N-[[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | COCCNCc1cnc(-c2cc3nccc(Oc4ccc(NC(=S)NC(=O)Cc5ccccc5)cc4F)c3s2)n1C |
| InChI | InChI=1S/C30H29FN6O3S2/c1-37-21(17-32-12-13-39-2)18-34-29(37)26-16-23-28(42-26)25(10-11-33-23)40-24-9-8-20(15-22(24)31)35-30(41)36-27(38)14-19-6-4-3-5-7-19/h3-11,15-16,18,32H,12-14,17H2,1-2H3,(H2,35,36,38,41) |
| InChIKey | DCPVJZNEQXYXET-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|