C17H29NO2 — CID 25276905
1-[[(2R,4R)-2-[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]pyrrolidine (PubChem CID 25276905) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-[[(2R,4R)-2-[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]pyrrolidine.
| Compound Name | 1-[[(2R,4R)-2-[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 25276905 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-[[(2R,4R)-2-[(1R,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]pyrrolidine |
| SMILES | CC1=C[C@H](C)[C@H]([C@@H]2OC[C@@H](CN3CCCC3)O2)[C@@H](C)C1 |
| InChI | InChI=1S/C17H29NO2/c1-12-8-13(2)16(14(3)9-12)17-19-11-15(20-17)10-18-6-4-5-7-18/h8,13-17H,4-7,9-11H2,1-3H3/t13-,14-,15+,16-,17+/m0/s1 |
| InChIKey | FTLAMGAOAHIHBM-ZOFXXKQRSA-N |
| XLogP | 3.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|