C15H26O2 — CID 98188712
(2S,5S)-4,4,5-trimethyl-2-[(1S,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolane (PubChem CID 98188712) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2S,5S)-4,4,5-trimethyl-2-[(1S,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolane.
| Compound Name | (2S,5S)-4,4,5-trimethyl-2-[(1S,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 98188712 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2S,5S)-4,4,5-trimethyl-2-[(1S,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolane |
| SMILES | CC1=C[C@@H](C)[C@@H]([C@H]2O[C@@H](C)C(C)(C)O2)[C@H](C)C1 |
| InChI | InChI=1S/C15H26O2/c1-9-7-10(2)13(11(3)8-9)14-16-12(4)15(5,6)17-14/h7,10-14H,8H2,1-6H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | DBIIWUMZCRECQE-RGDJUOJXSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|