C14H24O2 — CID 11900413
(2R,4S)-4-methyl-2-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxane (PubChem CID 11900413) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (2R,4S)-4-methyl-2-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxane.
| Compound Name | (2R,4S)-4-methyl-2-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 11900413 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2R,4S)-4-methyl-2-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxane |
| SMILES | CC1=C[C@H](C)[C@H]([C@@H]2OCC[C@H](C)O2)[C@H](C)C1 |
| InChI | InChI=1S/C14H24O2/c1-9-7-10(2)13(11(3)8-9)14-15-6-5-12(4)16-14/h7,10-14H,5-6,8H2,1-4H3/t10-,11+,12-,13-,14+/m0/s1 |
| InChIKey | ATFSHVJXFUUWIV-ZUWCUPBKSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|