C10H15N — CID 11899238
(1R,2R,6R)-2,4,6-trimethylcyclohex-3-ene-1-carbonitrile (PubChem CID 11899238) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (1R,2R,6R)-2,4,6-trimethylcyclohex-3-ene-1-carbonitrile.
| Compound Name | (1R,2R,6R)-2,4,6-trimethylcyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 11899238 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (1R,2R,6R)-2,4,6-trimethylcyclohex-3-ene-1-carbonitrile |
| SMILES | CC1=C[C@@H](C)[C@H](C#N)[C@H](C)C1 |
| InChI | InChI=1S/C10H15N/c1-7-4-8(2)10(6-11)9(3)5-7/h4,8-10H,5H2,1-3H3/t8-,9-,10+/m1/s1 |
| InChIKey | YUSPEOWVUKLLLZ-BBBLOLIVSA-N |
| XLogP | 2.75 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|