C12H18O2 — CID 130142788
5,7-dimethyl-1,4,4a,5,8,8a-hexahydronaphthalene-1,4-diol (PubChem CID 130142788) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 5,7-dimethyl-1,4,4a,5,8,8a-hexahydronaphthalene-1,4-diol.
| Compound Name | 5,7-dimethyl-1,4,4a,5,8,8a-hexahydronaphthalene-1,4-diol |
|---|---|
| PubChem CID | 130142788 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 5,7-dimethyl-1,4,4a,5,8,8a-hexahydronaphthalene-1,4-diol |
| SMILES | CC1=CC(C)C2C(O)C=CC(O)C2C1 |
| InChI | InChI=1S/C12H18O2/c1-7-5-8(2)12-9(6-7)10(13)3-4-11(12)14/h3-5,8-14H,6H2,1-2H3 |
| InChIKey | SOTMKDPSHCDIFR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|