C22H19N3O3S2 — CID 25320022
3-[4-(6-methylsulfanyl-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]chromen-2-one (PubChem CID 25320022) has the molecular formula C22H19N3O3S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 3-[4-(6-methylsulfanyl-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[4-(6-methylsulfanyl-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 25320022 |
| Molecular Formula | C22H19N3O3S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 3-[4-(6-methylsulfanyl-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]chromen-2-one |
| SMILES | CSc1ccc2nc(N3CCN(C(=O)c4cc5ccccc5oc4=O)CC3)sc2c1 |
| InChI | InChI=1S/C22H19N3O3S2/c1-29-15-6-7-17-19(13-15)30-22(23-17)25-10-8-24(9-11-25)20(26)16-12-14-4-2-3-5-18(14)28-21(16)27/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | VYHVDKQBVWDHQR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|