C19H19N3O4S2 — CID 25330618
methyl 4-methyl-3-[[4-(1-methylimidazol-2-yl)sulfanylphenyl]sulfamoyl]benzoate (PubChem CID 25330618) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is methyl 4-methyl-3-[[4-(1-methylimidazol-2-yl)sulfanylphenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-methyl-3-[[4-(1-methylimidazol-2-yl)sulfanylphenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25330618 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | methyl 4-methyl-3-[[4-(1-methylimidazol-2-yl)sulfanylphenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)Nc2ccc(Sc3nccn3C)cc2)c1 |
| InChI | InChI=1S/C19H19N3O4S2/c1-13-4-5-14(18(23)26-3)12-17(13)28(24,25)21-15-6-8-16(9-7-15)27-19-20-10-11-22(19)2/h4-12,21H,1-3H3 |
| InChIKey | AEFYCIDXDCTXNZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |