C19H21N5O4S2 — CID 25334429
1-ethyl-2-[(5-nitro-2-pyridinyl)sulfanyl]-5-piperidin-1-ylsulfonylbenzimidazole (PubChem CID 25334429) has the molecular formula C19H21N5O4S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-ethyl-2-[(5-nitro-2-pyridinyl)sulfanyl]-5-piperidin-1-ylsulfonylbenzimidazole.
| Compound Name | 1-ethyl-2-[(5-nitro-2-pyridinyl)sulfanyl]-5-piperidin-1-ylsulfonylbenzimidazole |
|---|---|
| PubChem CID | 25334429 |
| Molecular Formula | C19H21N5O4S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 1-ethyl-2-[(5-nitro-2-pyridinyl)sulfanyl]-5-piperidin-1-ylsulfonylbenzimidazole |
| SMILES | CCn1c(Sc2ccc([N+](=O)[O-])cn2)nc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C19H21N5O4S2/c1-2-23-17-8-7-15(30(27,28)22-10-4-3-5-11-22)12-16(17)21-19(23)29-18-9-6-14(13-20-18)24(25)26/h6-9,12-13H,2-5,10-11H2,1H3 |
| InChIKey | VXGPBNDJURJMBH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|