C26H20N4O3 — CID 2533545
3-hydroxy-4-[[(1-methyl-2-oxoindol-3-ylidene)hydrazinylidene]methyl]-2-(4-methylphenyl)isoquinolin-1-one (PubChem CID 2533545) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is 3-hydroxy-4-[[(1-methyl-2-oxoindol-3-ylidene)hydrazinylidene]methyl]-2-(4-methylphenyl)isoquinolin-1-one.
| Compound Name | 3-hydroxy-4-[[(1-methyl-2-oxoindol-3-ylidene)hydrazinylidene]methyl]-2-(4-methylphenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 2533545 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-hydroxy-4-[[(1-methyl-2-oxoindol-3-ylidene)hydrazinylidene]methyl]-2-(4-methylphenyl)isoquinolin-1-one |
| SMILES | Cc1ccc(-n2c(O)c(C=NN=C3C(=O)N(C)c4ccccc43)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H20N4O3/c1-16-11-13-17(14-12-16)30-24(31)19-8-4-3-7-18(19)21(25(30)32)15-27-28-23-20-9-5-6-10-22(20)29(2)26(23)33/h3-15,32H,1-2H3 |
| InChIKey | GZFKYNILBDFILS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|