C19H23N3O3S2 — CID 25343806
(2R)-N-methyl-N-phenyl-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide (PubChem CID 25343806) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is (2R)-N-methyl-N-phenyl-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide.
| Compound Name | (2R)-N-methyl-N-phenyl-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 25343806 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (2R)-N-methyl-N-phenyl-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1ccc(S(=O)(=O)N2CCCC2)cn1)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O3S2/c1-15(19(23)21(2)16-8-4-3-5-9-16)26-18-11-10-17(14-20-18)27(24,25)22-12-6-7-13-22/h3-5,8-11,14-15H,6-7,12-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | HPYYJDOKQVGXMM-OAHLLOKOSA-N |
| XLogP | 3.01 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |