C26H31N3O6S — CID 25345245
(3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 25345245) has the molecular formula C26H31N3O6S and a molecular weight of 513.62 g/mol. Its IUPAC name is (3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 25345245 |
| Molecular Formula | C26H31N3O6S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | (3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(CCN2C(=O)C[C@@H](N3CCN(S(=O)(=O)/C=C/c4ccccc4)CC3)C2=O)cc1OC |
| InChI | InChI=1S/C26H31N3O6S/c1-34-23-9-8-21(18-24(23)35-2)10-12-29-25(30)19-22(26(29)31)27-13-15-28(16-14-27)36(32,33)17-11-20-6-4-3-5-7-20/h3-9,11,17-18,22H,10,12-16,19H2,1-2H3/b17-11+/t22-/m1/s1 |
| InChIKey | OYIYUTTXHGYTAI-JRVGGCGHSA-N |
| XLogP | 1.99 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|