C20H13ClN4O3S — CID 25348859
N-(2-chlorophenyl)-2-(4-cyanoanilino)-1,3-benzoxazole-6-sulfonamide (PubChem CID 25348859) has the molecular formula C20H13ClN4O3S and a molecular weight of 424.87 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(4-cyanoanilino)-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-(2-chlorophenyl)-2-(4-cyanoanilino)-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 25348859 |
| Molecular Formula | C20H13ClN4O3S |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-(2-chlorophenyl)-2-(4-cyanoanilino)-1,3-benzoxazole-6-sulfonamide |
| SMILES | N#Cc1ccc(Nc2nc3ccc(S(=O)(=O)Nc4ccccc4Cl)cc3o2)cc1 |
| InChI | InChI=1S/C20H13ClN4O3S/c21-16-3-1-2-4-17(16)25-29(26,27)15-9-10-18-19(11-15)28-20(24-18)23-14-7-5-13(12-22)6-8-14/h1-11,25H,(H,23,24) |
| InChIKey | OXJLWVPNXCCXNI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |