C11H9Cl2NS2 — CID 2535200
5-[(3,4-dichlorophenyl)methyl]-4-methyl-3H-1,3-thiazole-2-thione (PubChem CID 2535200) has the molecular formula C11H9Cl2NS2 and a molecular weight of 290.24 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methyl]-4-methyl-3H-1,3-thiazole-2-thione.
| Compound Name | 5-[(3,4-dichlorophenyl)methyl]-4-methyl-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 2535200 |
| Molecular Formula | C11H9Cl2NS2 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methyl]-4-methyl-3H-1,3-thiazole-2-thione |
| SMILES | Cc1[nH]c(=S)sc1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2NS2/c1-6-10(16-11(15)14-6)5-7-2-3-8(12)9(13)4-7/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | VFQHQUJIQGTLEZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|