C23H32N4O3S — CID 25352078
(2S)-N-[3-(dimethylsulfamoyl)phenyl]-2-[4-(4-methylpiperidin-1-yl)anilino]propanamide (PubChem CID 25352078) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is (2S)-N-[3-(dimethylsulfamoyl)phenyl]-2-[4-(4-methylpiperidin-1-yl)anilino]propanamide.
| Compound Name | (2S)-N-[3-(dimethylsulfamoyl)phenyl]-2-[4-(4-methylpiperidin-1-yl)anilino]propanamide |
|---|---|
| PubChem CID | 25352078 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (2S)-N-[3-(dimethylsulfamoyl)phenyl]-2-[4-(4-methylpiperidin-1-yl)anilino]propanamide |
| SMILES | CC1CCN(c2ccc(N[C@@H](C)C(=O)Nc3cccc(S(=O)(=O)N(C)C)c3)cc2)CC1 |
| InChI | InChI=1S/C23H32N4O3S/c1-17-12-14-27(15-13-17)21-10-8-19(9-11-21)24-18(2)23(28)25-20-6-5-7-22(16-20)31(29,30)26(3)4/h5-11,16-18,24H,12-15H2,1-4H3,(H,25,28)/t18-/m0/s1 |
| InChIKey | MVAIBKXAZYUAQM-SFHVURJKSA-N |
| XLogP | 3.61 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|