C20H21BrN4OS — CID 25356312
1-[2-(4-bromophenyl)sulfanylethyl]-3-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]urea (PubChem CID 25356312) has the molecular formula C20H21BrN4OS and a molecular weight of 445.39 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)sulfanylethyl]-3-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]urea.
| Compound Name | 1-[2-(4-bromophenyl)sulfanylethyl]-3-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]urea |
|---|---|
| PubChem CID | 25356312 |
| Molecular Formula | C20H21BrN4OS |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 1-[2-(4-bromophenyl)sulfanylethyl]-3-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]urea |
| SMILES | Cn1ccnc1[C@H](NC(=O)NCCSc1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H21BrN4OS/c1-25-13-11-22-19(25)18(15-5-3-2-4-6-15)24-20(26)23-12-14-27-17-9-7-16(21)8-10-17/h2-11,13,18H,12,14H2,1H3,(H2,23,24,26)/t18-/m1/s1 |
| InChIKey | DIRBFBCOGLHNAD-GOSISDBHSA-N |
| XLogP | 4.36 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|