C23H27NO2 — CID 25367584
1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]pent-4-en-1-one (PubChem CID 25367584) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is 1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]pent-4-en-1-one.
| Compound Name | 1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 25367584 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCO[C@@H](CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H27NO2/c1-2-3-14-23(25)24-15-16-26-21(18-24)17-22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h2,4-13,21-22H,1,3,14-18H2/t21-/m0/s1 |
| InChIKey | QIWRQVKZPMARQV-NRFANRHFSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|