C24H23NO4 — CID 42376886
1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-2-(furan-2-yl)ethane-1,2-dione (PubChem CID 42376886) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-2-(furan-2-yl)ethane-1,2-dione.
| Compound Name | 1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-2-(furan-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 42376886 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-2-(furan-2-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCO[C@@H](CC(c2ccccc2)c2ccccc2)C1)c1ccco1 |
| InChI | InChI=1S/C24H23NO4/c26-23(22-12-7-14-29-22)24(27)25-13-15-28-20(17-25)16-21(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-12,14,20-21H,13,15-17H2/t20-/m0/s1 |
| InChIKey | DMNDPLIBKVPBCD-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|