C23H30N2O2 — CID 95468828
3-[(2R)-2-(2,2-diphenylethyl)morpholin-4-yl]-N,N-dimethylpropanamide (PubChem CID 95468828) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-[(2R)-2-(2,2-diphenylethyl)morpholin-4-yl]-N,N-dimethylpropanamide.
| Compound Name | 3-[(2R)-2-(2,2-diphenylethyl)morpholin-4-yl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 95468828 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 3-[(2R)-2-(2,2-diphenylethyl)morpholin-4-yl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCN1CCO[C@H](CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H30N2O2/c1-24(2)23(26)13-14-25-15-16-27-21(18-25)17-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,21-22H,13-18H2,1-2H3/t21-/m1/s1 |
| InChIKey | XPWASMOWOCCPLM-OAQYLSRUSA-N |
| XLogP | 3.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |