C21H27NO3 — CID 56862185
2-[2-(2,2-diphenylethyl)morpholin-4-yl]propane-1,3-diol (PubChem CID 56862185) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[2-(2,2-diphenylethyl)morpholin-4-yl]propane-1,3-diol.
| Compound Name | 2-[2-(2,2-diphenylethyl)morpholin-4-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 56862185 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[2-(2,2-diphenylethyl)morpholin-4-yl]propane-1,3-diol |
| SMILES | OCC(CO)N1CCOC(CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H27NO3/c23-15-19(16-24)22-11-12-25-20(14-22)13-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,19-21,23-24H,11-16H2 |
| InChIKey | NXRABNNPCSKXFK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |