C18H24N4O3 — CID 25369060
5-(2,4-dimethoxyphenyl)-N-[2-[(2R)-oxan-2-yl]ethyl]-1,2,4-triazin-3-amine (PubChem CID 25369060) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-N-[2-[(2R)-oxan-2-yl]ethyl]-1,2,4-triazin-3-amine.
| Compound Name | 5-(2,4-dimethoxyphenyl)-N-[2-[(2R)-oxan-2-yl]ethyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 25369060 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-N-[2-[(2R)-oxan-2-yl]ethyl]-1,2,4-triazin-3-amine |
| SMILES | COc1ccc(-c2cnnc(NCC[C@H]3CCCCO3)n2)c(OC)c1 |
| InChI | InChI=1S/C18H24N4O3/c1-23-14-6-7-15(17(11-14)24-2)16-12-20-22-18(21-16)19-9-8-13-5-3-4-10-25-13/h6-7,11-13H,3-5,8-10H2,1-2H3,(H,19,21,22)/t13-/m1/s1 |
| InChIKey | GOEFLYYGNKNCHD-CYBMUJFWSA-N |
| XLogP | 2.93 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |