C15H17FN4 — CID 25373449
1-[5-(3-fluorophenyl)-1,2,4-triazin-3-yl]azepane (PubChem CID 25373449) has the molecular formula C15H17FN4 and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-[5-(3-fluorophenyl)-1,2,4-triazin-3-yl]azepane.
| Compound Name | 1-[5-(3-fluorophenyl)-1,2,4-triazin-3-yl]azepane |
|---|---|
| PubChem CID | 25373449 |
| Molecular Formula | C15H17FN4 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-[5-(3-fluorophenyl)-1,2,4-triazin-3-yl]azepane |
| SMILES | Fc1cccc(-c2cnnc(N3CCCCCC3)n2)c1 |
| InChI | InChI=1S/C15H17FN4/c16-13-7-5-6-12(10-13)14-11-17-19-15(18-14)20-8-3-1-2-4-9-20/h5-7,10-11H,1-4,8-9H2 |
| InChIKey | JQHGJQKXGNQUHQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |