About 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane
1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane (PubChem CID 42508182) has the molecular formula C19H20N4
and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane.
Molecular Properties
| Compound Name | 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane |
| PubChem CID | 42508182 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane |
| SMILES | c1ccc2c(-c3cnnc(N4CCCCCC4)n3)cccc2c1 |
| InChI | InChI=1S/C19H20N4/c1-2-6-13-23(12-5-1)19-21-18(14-20-22-19)17-11-7-9-15-8-3-4-10-16(15)17/h3-4,7-11,14H,1-2,5-6,12-13H2 |
| InChIKey | GABMHOLOPVGKQW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane?
The IUPAC name of 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane (CID 42508182) is 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane.
What is the SMILES notation for 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane?
The canonical SMILES for 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane is c1ccc2c(-c3cnnc(N4CCCCCC4)n3)cccc2c1.
What is the InChIKey of 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane?
The InChIKey is GABMHOLOPVGKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4/c1-2-6-13-23(12-5-1)19-21-18(14-20-22-19)17-11-7-9-15-8-3-4-10-16(15)17/h3-4,7-11,14H,1-2,5-6,12-13H2.
What are the key properties of 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane?
1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane has a molecular weight of 304.40 g/mol, XLogP of 4.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-naphthalen-1-yl-1,2,4-triazin-3-yl)azepane is sourced from PubChem (CID 42508182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).