C26H30FN3O3 — CID 25389654
methyl (2S,4S,6S,12bR)-4-(2-fluorophenyl)-2-(2-methoxyethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate (PubChem CID 25389654) has the molecular formula C26H30FN3O3 and a molecular weight of 451.54 g/mol. Its IUPAC name is methyl (2S,4S,6S,12bR)-4-(2-fluorophenyl)-2-(2-methoxyethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate.
| Compound Name | methyl (2S,4S,6S,12bR)-4-(2-fluorophenyl)-2-(2-methoxyethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
|---|---|
| PubChem CID | 25389654 |
| Molecular Formula | C26H30FN3O3 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | methyl (2S,4S,6S,12bR)-4-(2-fluorophenyl)-2-(2-methoxyethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
| SMILES | COCCN[C@@H]1C[C@@H]2c3[nH]c4ccccc4c3C[C@@H](C(=O)OC)N2[C@H](c2ccccc2F)C1 |
| InChI | InChI=1S/C26H30FN3O3/c1-32-12-11-28-16-13-22(18-8-3-5-9-20(18)27)30-23(14-16)25-19(15-24(30)26(31)33-2)17-7-4-6-10-21(17)29-25/h3-10,16,22-24,28-29H,11-15H2,1-2H3/t16-,22-,23+,24-/m0/s1 |
| InChIKey | BYZLIKDEGSCOKO-AGCMCZDNSA-N |
| XLogP | 3.89 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|