C28H34N4O3 — CID 74451133
methyl 2-(2-acetamidoethylamino)-4-(4-methylphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate (PubChem CID 74451133) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is methyl 2-(2-acetamidoethylamino)-4-(4-methylphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate.
| Compound Name | methyl 2-(2-acetamidoethylamino)-4-(4-methylphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
|---|---|
| PubChem CID | 74451133 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | methyl 2-(2-acetamidoethylamino)-4-(4-methylphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)C2CC(NCCNC(C)=O)CC(c3ccc(C)cc3)N12 |
| InChI | InChI=1S/C28H34N4O3/c1-17-8-10-19(11-9-17)24-14-20(30-13-12-29-18(2)33)15-25-27-22(16-26(32(24)25)28(34)35-3)21-6-4-5-7-23(21)31-27/h4-11,20,24-26,30-31H,12-16H2,1-3H3,(H,29,33) |
| InChIKey | KFIDKOIJKFVSEG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|