C29H30N4O2 — CID 28991343
methyl (2R,4S,6S,12bR)-4-phenyl-2-(pyridin-3-ylmethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate (PubChem CID 28991343) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is methyl (2R,4S,6S,12bR)-4-phenyl-2-(pyridin-3-ylmethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate.
| Compound Name | methyl (2R,4S,6S,12bR)-4-phenyl-2-(pyridin-3-ylmethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
|---|---|
| PubChem CID | 28991343 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | methyl (2R,4S,6S,12bR)-4-phenyl-2-(pyridin-3-ylmethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2C[C@H](NCc3cccnc3)C[C@@H](c3ccccc3)N21 |
| InChI | InChI=1S/C29H30N4O2/c1-35-29(34)27-16-23-22-11-5-6-12-24(22)32-28(23)26-15-21(31-18-19-8-7-13-30-17-19)14-25(33(26)27)20-9-3-2-4-10-20/h2-13,17,21,25-27,31-32H,14-16,18H2,1H3/t21-,25+,26-,27+/m1/s1 |
| InChIKey | VFDHQGGTIAPYKZ-DXXVALNZSA-N |
| XLogP | 4.70 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|