C28H29N3O2S — CID 25389838
methyl (2R,4S,6S,12bR)-4-phenyl-2-(thiophen-2-ylmethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate (PubChem CID 25389838) has the molecular formula C28H29N3O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is methyl (2R,4S,6S,12bR)-4-phenyl-2-(thiophen-2-ylmethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate.
| Compound Name | methyl (2R,4S,6S,12bR)-4-phenyl-2-(thiophen-2-ylmethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
|---|---|
| PubChem CID | 25389838 |
| Molecular Formula | C28H29N3O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | methyl (2R,4S,6S,12bR)-4-phenyl-2-(thiophen-2-ylmethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2C[C@H](NCc3cccs3)C[C@@H](c3ccccc3)N21 |
| InChI | InChI=1S/C28H29N3O2S/c1-33-28(32)26-16-22-21-11-5-6-12-23(21)30-27(22)25-15-19(29-17-20-10-7-13-34-20)14-24(31(25)26)18-8-3-2-4-9-18/h2-13,19,24-26,29-30H,14-17H2,1H3/t19-,24+,25-,26+/m1/s1 |
| InChIKey | SRWNJDQBBOTCLI-IWRQBJDLSA-N |
| XLogP | 5.36 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|