C25H25F4N3O2 — CID 74451138
methyl 4-(2-fluorophenyl)-2-(2,2,2-trifluoroethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate (PubChem CID 74451138) has the molecular formula C25H25F4N3O2 and a molecular weight of 475.49 g/mol. Its IUPAC name is methyl 4-(2-fluorophenyl)-2-(2,2,2-trifluoroethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate.
| Compound Name | methyl 4-(2-fluorophenyl)-2-(2,2,2-trifluoroethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
|---|---|
| PubChem CID | 74451138 |
| Molecular Formula | C25H25F4N3O2 |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | methyl 4-(2-fluorophenyl)-2-(2,2,2-trifluoroethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)C2CC(NCC(F)(F)F)CC(c3ccccc3F)N12 |
| InChI | InChI=1S/C25H25F4N3O2/c1-34-24(33)22-12-17-15-6-3-5-9-19(15)31-23(17)21-11-14(30-13-25(27,28)29)10-20(32(21)22)16-7-2-4-8-18(16)26/h2-9,14,20-22,30-31H,10-13H2,1H3 |
| InChIKey | DBRKEBWNZAKPKM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|