C26H43N3O4S — CID 25395281
N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 25395281) has the molecular formula C26H43N3O4S and a molecular weight of 493.71 g/mol. Its IUPAC name is N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 25395281 |
| Molecular Formula | C26H43N3O4S |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(C(=O)NCC(C)(C)N3C[C@@H](C)O[C@@H](C)C3)CC2)c1C |
| InChI | InChI=1S/C26H43N3O4S/c1-17-13-18(2)22(6)24(21(17)5)34(31,32)29-11-9-23(10-12-29)25(30)27-16-26(7,8)28-14-19(3)33-20(4)15-28/h13,19-20,23H,9-12,14-16H2,1-8H3,(H,27,30)/t19-,20+ |
| InChIKey | QLRMLSVGMYWMPF-BGYRXZFFSA-N |
| XLogP | 3.32 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |