C24H19BrN4O2S — CID 25403346
[(6R,7S)-6-(4-bromophenyl)-3-(2-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-phenylmethanone (PubChem CID 25403346) has the molecular formula C24H19BrN4O2S and a molecular weight of 507.41 g/mol. Its IUPAC name is [(6R,7S)-6-(4-bromophenyl)-3-(2-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-phenylmethanone.
| Compound Name | [(6R,7S)-6-(4-bromophenyl)-3-(2-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-phenylmethanone |
|---|---|
| PubChem CID | 25403346 |
| Molecular Formula | C24H19BrN4O2S |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | [(6R,7S)-6-(4-bromophenyl)-3-(2-methoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-phenylmethanone |
| SMILES | COc1ccccc1-c1nnc2n1N[C@H](c1ccc(Br)cc1)[C@@H](C(=O)c1ccccc1)S2 |
| InChI | InChI=1S/C24H19BrN4O2S/c1-31-19-10-6-5-9-18(19)23-26-27-24-29(23)28-20(15-11-13-17(25)14-12-15)22(32-24)21(30)16-7-3-2-4-8-16/h2-14,20,22,28H,1H3/t20-,22+/m1/s1 |
| InChIKey | PLNOJDOMRHVEDZ-IRLDBZIGSA-N |
| XLogP | 5.36 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |