C24H24N4O3S2 — CID 25405082
N-[(1R)-1,2-diphenylethyl]-2-(1-methyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 25405082) has the molecular formula C24H24N4O3S2 and a molecular weight of 480.62 g/mol. Its IUPAC name is N-[(1R)-1,2-diphenylethyl]-2-(1-methyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(1R)-1,2-diphenylethyl]-2-(1-methyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 25405082 |
| Molecular Formula | C24H24N4O3S2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-[(1R)-1,2-diphenylethyl]-2-(1-methyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | Cn1c(SCC(=O)N[C@H](Cc2ccccc2)c2ccccc2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C24H24N4O3S2/c1-28-22-13-12-19(33(25,30)31)15-21(22)27-24(28)32-16-23(29)26-20(18-10-6-3-7-11-18)14-17-8-4-2-5-9-17/h2-13,15,20H,14,16H2,1H3,(H,26,29)(H2,25,30,31)/t20-/m1/s1 |
| InChIKey | CKTHWURLAKULPN-HXUWFJFHSA-N |
| XLogP | 3.41 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |