C22H17ClN2O4 — CID 25408125
(2R)-2-(5-chloro-2-hydroxyphenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-dihydroquinazolin-4-one (PubChem CID 25408125) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is (2R)-2-(5-chloro-2-hydroxyphenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-2-(5-chloro-2-hydroxyphenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 25408125 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (2R)-2-(5-chloro-2-hydroxyphenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](c2cc(Cl)ccc2O)N1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H17ClN2O4/c23-13-5-7-18(26)16(11-13)21-24-17-4-2-1-3-15(17)22(27)25(21)14-6-8-19-20(12-14)29-10-9-28-19/h1-8,11-12,21,24,26H,9-10H2/t21-/m1/s1 |
| InChIKey | TVEMTFIBDVGACO-OAQYLSRUSA-N |
| XLogP | 4.59 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|