C16H26O — CID 25422397
(4aR,6R,6aR,10bR)-6-propan-2-yl-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromene (PubChem CID 25422397) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (4aR,6R,6aR,10bR)-6-propan-2-yl-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromene.
| Compound Name | (4aR,6R,6aR,10bR)-6-propan-2-yl-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromene |
|---|---|
| PubChem CID | 25422397 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (4aR,6R,6aR,10bR)-6-propan-2-yl-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromene |
| SMILES | CC(C)[C@H]1O[C@@H]2CCCC[C@@H]2C2=CCCC[C@H]21 |
| InChI | InChI=1S/C16H26O/c1-11(2)16-14-9-4-3-7-12(14)13-8-5-6-10-15(13)17-16/h7,11,13-16H,3-6,8-10H2,1-2H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | WUODFZJMRMJWIS-KLHDSHLOSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|