C29H30N4O3 — CID 25422486
N-[(Z)-3-[2-(1H-benzimidazol-2-yl)ethylamino]-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]-4-methylbenzamide (PubChem CID 25422486) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[(Z)-3-[2-(1H-benzimidazol-2-yl)ethylamino]-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]-4-methylbenzamide.
| Compound Name | N-[(Z)-3-[2-(1H-benzimidazol-2-yl)ethylamino]-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 25422486 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | N-[(Z)-3-[2-(1H-benzimidazol-2-yl)ethylamino]-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C\c2ccc(OC(C)C)cc2)C(=O)NCCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C29H30N4O3/c1-19(2)36-23-14-10-21(11-15-23)18-26(33-28(34)22-12-8-20(3)9-13-22)29(35)30-17-16-27-31-24-6-4-5-7-25(24)32-27/h4-15,18-19H,16-17H2,1-3H3,(H,30,35)(H,31,32)(H,33,34)/b26-18- |
| InChIKey | MYIAMXLITYBDBB-ITYLOYPMSA-N |
| XLogP | 4.79 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|