C26H23ClN4O3 — CID 4908959
N-[3-[2-(1H-benzimidazol-2-yl)ethylamino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-2-chlorobenzamide (PubChem CID 4908959) has the molecular formula C26H23ClN4O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is N-[3-[2-(1H-benzimidazol-2-yl)ethylamino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-2-chlorobenzamide.
| Compound Name | N-[3-[2-(1H-benzimidazol-2-yl)ethylamino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 4908959 |
| Molecular Formula | C26H23ClN4O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[3-[2-(1H-benzimidazol-2-yl)ethylamino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
| SMILES | COc1ccc(C=C(NC(=O)c2ccccc2Cl)C(=O)NCCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C26H23ClN4O3/c1-34-18-12-10-17(11-13-18)16-23(31-25(32)19-6-2-3-7-20(19)27)26(33)28-15-14-24-29-21-8-4-5-9-22(21)30-24/h2-13,16H,14-15H2,1H3,(H,28,33)(H,29,30)(H,31,32) |
| InChIKey | VVUVAUSZPYWAOH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|