C29H27N3O2 — CID 25427074
(10S,15S)-13-(3-methylphenyl)-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 25427074) has the molecular formula C29H27N3O2 and a molecular weight of 449.55 g/mol. Its IUPAC name is (10S,15S)-13-(3-methylphenyl)-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (10S,15S)-13-(3-methylphenyl)-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 25427074 |
| Molecular Formula | C29H27N3O2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | (10S,15S)-13-(3-methylphenyl)-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | Cc1cccc(N2C(=O)[C@@H]3Cc4c([nH]c5ccccc45)[C@H](c4ccc(C(C)C)cc4)N3C2=O)c1 |
| InChI | InChI=1S/C29H27N3O2/c1-17(2)19-11-13-20(14-12-19)27-26-23(22-9-4-5-10-24(22)30-26)16-25-28(33)31(29(34)32(25)27)21-8-6-7-18(3)15-21/h4-15,17,25,27,30H,16H2,1-3H3/t25-,27-/m0/s1 |
| InChIKey | WAVGGBXCHKUNRA-BDYUSTAISA-N |
| XLogP | 6.08 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|